Crom Sắt Đồng




1. Crom - Sắt - Đồng                                                          

- Cấu hình electron nguyên tử Cr : [Ar]3d54s1; Fe : [Ar]3d64s2, Cu : [Ar]3d104s1.

- Thế điện cực chuẩn = -0,74V; = -0,44V; = 0,77V, = 0,34V.

2. Sơ đồ minh hoạ tính chất hoá học của crom

                               + O2, t0                  Cr2O3 (r)   + NH3    CrO3

                               + bột Al                                          Nước

                               + Cl2, t0                      CrCl3 (r)          H2CrO4


Cr          HCl          (dd)     + Cl2          (dd)   +Br2(dd)

               H2SO4(l)                   +Zn                          +SO2, KI  

                        Kiềm    Axit                             Axit                   

                               Cr(OH)+(O2+H2O)    Cr(OH)3                       





Số oxi hoá +2

Số oxi hoá +3

Số oxi hoá +6

- Tính khử.

- Tính khử và tính oxi hoá.

- Tính oxi hoá.

- Oxit và hiđroxit có tính bazơ.

- Oxit và hiđroxit có tính lưỡng tính.

- Oxit và hiđroxit có tính axit.

3. Sơ đồ minh hoạ tính chất hoá học của sắt và hợp chất

Text Box:





Số oxi hoá +2

Số oxi hoá +3

- Tính khử.

- Tính oxi hoá.

- Oxit và hiđroxit có tính bazơ.

- Oxit và hiđroxit có tính bazơ.


4. Sơ đồ minh hoạ tính chất hoá học đồng



Số oxi hoá +2

- Tính oxi hoá.

- Oxit và hiđroxit có tính bazơ.


5. Sơ lược về các kim loại Ag, Au, Ni, Zn, Sn, Pb









Số oxi hoá

+1, (+2)

+1, +3

+2, (+3)


+2, +4

+2, +4














Tính khử

Rất yếu

Rất yếu







(Lưu ý: Các dòng  in nghiêng là phần nâng cao)

1.                     Fe + S                           FeS.

2.                     3Fe + 2O2                     Fe3O4.

3.                     2Fe + 3Cl2        2FeCl3.

4.                     Fe + 2HCl                     FeCl2 + H2.

5.                     Fe + H2SO4 loãng            FeSO4 + H2.

6.                     2Fe + 6H2SO4 đặc          Fe2(SO4)3 + 3SO2 + 6H2O.

7.                     Fe + 4HNO3 loãng          Fe(NO3)3 + NO + 2H2O.

8.                     Fe + 6HNO3 đặc             Fe(NO3)3 + 3NO2 + 3H2O.

9.                     Fe (dư) + HNO3  Fe(NO3)2 + .....

10.       Fe (dư) + H2SO4 (đặc)  FeSO4 + .....

11.       Fe + CuSO4      FeSO4 + Cu.

12.       Fe + 2AgNO3   Fe(NO3)2 + 2Ag.

13.       Fe + 3AgNO3 (dư)  Fe(NO3)3 + ....

14.       3Fe + 4H2O                  Fe3O4 + 4H2.

15.       Fe + H2O                     FeO + H2.

16.       3FeO + 10HNO3 đặc      3Fe(NO3)3 + NO + 5H2O.

17.       2FeO + 4H2SO4 đặc        Fe2(SO4)3 + SO2 + 4H2O.

18.       FeO + H2SO4  loãng        FeSO4 + H2O.

19.       FeO + 2HCl  FeCl2 + H2O.

20.       FeO + CO  Fe + CO2.

21.       Fe(OH)2 + 2HCl  FeCl2 + 2H2O.

22.       Fe(OH)2 + H2SO4  FeSO4 + 2H2O.

23.       4Fe(OH)2 + O2 + 2H2O            4Fe(OH)3.

24.       FeCl2 + 2NaOH            Fe(OH)2 + 2NaCl.

25.       2FeCl2 + Cl2                 2FeCl3.

26.    10FeSO4 + 2KMnO4 + 8H2SO4  5Fe2(SO4)3 + K2SO4 + 2MnSO4 + 8H2O.

27.       3Fe2O3 + CO    2Fe3O4 + CO2.

28.       Fe2O3 + CO                  2FeO + CO2.

29.       Fe2O3 + 3CO    2Fe + 3CO2.

30.       Fe2O3 + 3H2SO4          loãng        Fe2(SO4)3 + 3H2O.

31.       Fe2O3 + 6HCl  2FeCl3 + 3H2O.

32.       Fe2O3 + 3H2SO4           Fe2(SO4)3 + 3H2O.

33.       FeCl3 + 3NaOH            Fe(OH)3 + 3NaCl.

34.       2FeCl3 + Fe                  3FeCl2.

35.       2FeCl3 + Cu                   2FeCl2 + CuCl2.

36.       2FeCl3 + 2KI  2FeCl2 + 2KCl + I2.

37.       2Fe(OH)3                                  Fe2O3  + 3H2O.

38.       2Fe(OH)3 + 3H2SO4     Fe2(SO4)3 + 6H2O.

39.       Fe(OH)3 + 3HCl                                   FeCl3 + 3H2O.

40.       2FeS2 + 14H2SO4  Fe2(SO4)3 + 15SO2 + 14H2O.

41.       4FeS2 + 11O2              2Fe2O3 + 8SO2.

42.       4Cr + 3O2                     2Cr2O3.

43.       2Cr + 3Cl2                    2CrCl3.

44.       2Cr + 3S                       Cr2S3.

45.       Cr + 2HCl                     CrCl2 + H2.

46.       Cr + H2SO4      CrSO4 + H2.

47.       2Cr + 3SnCl2  2CrCl3 + 3Sn.

48.       4Cr(OH)2 + O2 + 2H2O            4Cr(OH)3.

49.       Cr(OH)2 + 2HCl  CrCl2 + 2H2O.

50.       Cr(OH)3 + NaOH         Na[Cr(OH)4]  (hay NaCrO2).

51.       Cr(OH)3 + 3HCl                       CrCl3 + 3H2O.

52.       2Cr(OH)3          Cr2O3 + 3H2O.

53.       2CrO + O2  2Cr2O3.

54.       CrO + 2HCl  CrCl2 + H2O.

55.       Cr2O3 + 3H2SO4           Cr2(SO4)3 + 3H2O.

56.       2Cr2O3 + 8NaOH + 3O2  4Na2CrO4 + 4H2O.

57.       Cr2O3 + 2Al  2Cr + Al2O3.

58.       CrO3 + H2O      H2CrO4.

59.       2CrO3 + H2O                H2Cr2O7.

60.       4CrO3               2Cr2O3 + 3O2.

61.       2CrO3 + 2NH3  Cr2O3 + N2 + 3H2O.

62.       4CrCl2 + O2 + 4HCl  4CrCl3 + 2H2O.

63.       CrCl2 + 2NaOH            Cr(OH)2 + 2NaCl.

64.       2CrCl2 + Cl2  2CrCl3.

65.       2CrCl3 + Zn  ZnCl2 + 2CrCl2.

66.       CrCl3 + 3NaOH  Cr(OH)3 + 3NaCl.

67.       2CrCl3 + 3Cl2 + 16NaOH  2Na2CrO4 + 12NaCl + 8H2O.

68.       2NaCrO2 + 3Br2 + 8NaOH 2Na2CrO4 + 6NaBr +4H2O

69.       2Na2Cr2O7 + 3C  2Na2CO3 + CO2 + 2Cr2O3.

70.       Na2Cr2O7 + S  Na2SO4 + Cr2O3.

71.       Na2Cr2O7 + 14HCl  2CrCl3 + 2NaCl +3Cl2+ 7H2O.

72.       K2Cr2O7 + 3H2S + 4H2SO4 Cr2(SO4)3 +3S + K2SO4 + 7H2O.

73.       K2Cr2O7 + 3K2SO3 + 4H2SO4  Cr2(SO4)3 + 4K2SO4 + 4H2O.

74.       K2Cr2O7+6KI+7H2SO4 Cr2(SO4)3+4K2SO4+3I2+7H2O.

75.     K2Cr2O7 + 6FeSO4 + 7H2SO4  3Fe2(SO4)3 + Cr2(SO4)3 + K2SO4 + 7H2O.

76.       (NH4)2Cr2O7     Cr2O3 + N2 + 4H2O.

77.       2Na2Cr2O7                    2Na2O + 2Cr2O3 + 3O2.

78.       2Na2CrO4 + H2SO4  Na2Cr2O7 + Na2SO4 + H2O.

79.       Cu + Cl2            CuCl2.

80.       2Cu + O2          2CuO.

81.       Cu + S              CuS.

82.       Cu + 2H2SO4 đặc            CuSO4 + SO2 + 2H2O.

83.       Cu + 4HNO3 đặc                        Cu(NO3)2 + 2NO2 + 2H2O.

84.       3Cu + 8HNO3 loãng        3Cu(NO3)2 + 2NO + 4H2O.

85.       Cu + 2AgNO3  Cu(NO3)2 + 2Ag.

86.       Cu + 2FeCl3  CuCl2 + 2FeCl2.

87.     3Cu + 8NaNO3 + 4H2SO4  3Cu(NO3)2 + 4Na2SO4 + 2NO + 4H2O.

88.       2Cu + 4HCl + O2  2CuCl2 + 2H2O.

89.       CuO + H2SO4   CuSO4 + H2O.

90.       CuO + 2HCl     CuCl2 + H2O.

91.       CuO + H2         Cu + H2O.

92.       CuO + CO  Cu + CO2.

93.       3CuO + 2NH3  N2 + 3Cu + 3H2O.

94.       CuO + Cu  Cu2O.

95.       Cu2O + H2SO4 loãng  CuSO4 + Cu + H2O.

96.       Cu(OH)2 + 2HCl                       CuCl2 + 2H2O.

97.       Cu(OH)2 + H2SO4  CuSO4 + 2H2O.

98.       Cu(OH)2           CuO + H2O.

99.       Cu(OH)2 + 4NH3          [Cu(NH3)4]2+ + 2OH-.

100.                 2Cu(NO3)2  2CuO + 2NO2 + 3O2.

101.                 CuCl2    Cu + Cl2.

102.                 2Cu(NO3)2       + 2H2O             2Cu + 4HNO3 + O2.

103.                 2CuSO4 + 2H2O           2Cu + 2H2SO4 + O2.

104.                 CuCO3.Cu(OH)2  2CuO + CO2 + H2O.

105.                 CuS + 2AgNO3            2AgS + Cu(NO3)2.

106.                 CuS + 4H2SO4 đặc         CuSO4 + 4SO2 + 4H2O.

107.                 2Ni + O2  2NiO.

108.                 Ni + Cl2            NiCl2.

109.                 Zn + O2            2ZnO.

110.                 Zn + S   ZnS.

111.                 Zn + Cl2  ZnCl2.

112.                 2Pb + O2  2PbO.

113.                 Pb + S              PbS.

114.                 3Pb + 8HNO3 loãng  3Pb(NO3)2 + 2NO + 4H2O.

115.                 Sn + 2HCl         SnCl2 + H2.

116.                 Sn + O2                         SnO2.


118.                 Ag + 2HNO3(đặc)  AgNO3 + NO2 + H2O.

119.                 2Ag + 2H2S + O2  2Ag2S + 2H2O.

120.                 2Ag + O3  Ag2O + O2.

121.                 Ag2O + H2O2  2Ag + H2O + O2.

122.                 2AgNO3  2Ag + 2NO2 + O2.

123.                 4AgNO3 + 2H2O  4Ag + 4HNO3 + O2.

124.                 Au +HNO3 + 3HCl  AuCl3 + 2H2O + NO.




Câu 7.1 Các kim loại thuộc dãy nào sau đây đều phản ứng với dung dịch CuCl2 ?

            A. Na, Mg, Ag.            B. Fe, Na, Mg.             C. Ba, Mg, Hg.                        D. Na, Ba, Ag.

Câu 7.2 Cấu hình electron nào sau đây là của ion  ?

            A. [Ar]3d6.       B.         [Ar]3d5.                       C. [Ar]3d4.                               D.[Ar]3d3.

Câu 7.3 Quặng sắt nào sau đây có hàm lượng sắt lớn nhất ?

            A. Hematit.                   B. Manhetit.                 C. Xiđerit.                                D. Pirit sắt.

Câu 7.4 Các số oxi hoá đặc trưng của crom là ?

            A. +2, +4, +6.              B. +2, +3, +6.              C. +1, +2, +4, +6.                   D. +3, +4, +6.

Câu 7.5 Khi nung Na2Cr2O7 thu được Na2O, Cr2O3, O2. Phản ứng trên thuộc loại phản ứng nào sau đây ?

            A. Phản ứng oxi hoá- khử phức tạp.

            B. Phản ứng oxi hoá- khử nội phân tử.

            C. Phản ứng tự oxi hoá- khử.

            D. Phản ứng phân huỷ không phải là oxi hoá- khử.

Câu 7.6. Cấu hình electron của ion Cu2+

            A. [Ar]3d7.                   B. [Ar]3d8.                   C. [Ar]3d9.                               D. [Ar]3d10.

Câu 7.7 Hợp chất nào sau đây không có tính chất lưỡng tính ?

            A. ZnO.                       B. Zn(OH)2.                 C. ZnSO4.                                D. Zn(HCO3)2.

Câu 7.8 Cho dung dịch NaOH vào dung dịch muối sunfat của kim loại hoá trị 2 thấy sinh ra kết tủa tan trong dung dịch NaOH dư. Đó là muối nào sau đây ?

            A. MgSO4.                   B. CaSO4.                    C. MnSO4.                               D. ZnSO4.

Câu 7.9 Khi nung nóng một thanh thép thì độ dẫn điện của thanh thép thay đổi như thế nào ?

            A. Tăng lên.                                          B. Giảm đi.

            C. Không thay đổi.                               D. Tăng hay giảm còn tuỳ thuộc vào thành phần của thép.

Câu 7.10 Phân biệt 3 mẫu hợp kim sau : Al-Fe, Al-Cu, Cu-Fe bằng phương pháp hoá học. Hoá chất cần dùng là :

            A. Dung dịch : NaOH, HCl.                                          B. Dung dịch  : KOH, H2SO4 loãng.

            C. HNO3 đặc nguội, dung dịch NaOH.             D. Cả A, B, C đều đúng.

Câu 7.11 Cho Cu tác dụng với dung dịch hỗn hợp gồm NaNO3 và H2SO4 loãng sẽ giải phóng khí nào sau đây ?

            A. NO2.                       B. NO.                         C. N2O.                                   D. NH3.

Câu 7.12 Cho biết câu nào không đúng trong các câu sau:

            A. Crom là kim loại có tính khử mạnh hơn sắt.

            B. CrO là oxít bazơ.

            C. Kim loại Cr có thể cắt được thuỷ tinh.

            D. Phương pháp sản xuất Cr là điện phân Cr2O3 nóng chảy.

Câu 7.13 Có 2 lá sắt khối lượng bằng nhau. Lá 1 cho tác dụng với dung dịch HCl dư thu được m1 g muối khan. Lá 2 đốt trong khí clo dư thu được m2g muối. Mối liên hệ giữa m1 và m2

            A. m1=m2.                    B. m1>m2.                    C. m2>m1.                    D. Không xác định được.

Câu 7.14 Điền đáp án đúng nhất vào dấu (…) trong câu sau:

Cho các chất : FeO(1), Fe2O3(2), Fe3O4(3), FeS(4), FeS2(5), FeSO4(6), Fe2(SO4)3(7), FeSO3(8).

a. Chất có phần trăm khối lượng sắt lớn nhất là…………

b. Chất có phần trăm khối lượng sắt nhỏ nhất là…………

Câu 7.15 Cho biết câu sai trong các câu sau :

            A. Fe có khả năng tan trong dung dịch FeCl3.

            B. Ag có khả năng tan trong dung dịch FeCl3.

            C. Cu có khả năng tan trong dung dịch FeCl3.

            D. Dung dịch AgNO3 có khả năng tác dụng với dung dịch FeCl2.

Câu 7.16 Trong phòng thí nghiệm, để bảo quản dung dịch muối sắt (II), người ta thường cho vào đó :

            A. dung dịch HCl.         B. sắt kim loại.  C. dung dịch H2SO4.                D. dung dịch AgNO3.

Câu 7.17 Điền đáp án đúng nhất vào dấu (…) trong câu sau:

Cho các chất: CuO(1), Cu2O(2), CuS(3), Cu2S(4), CuSO4(5), CuSO4.5H2O(6).

a. Chất có % khối lượng đồng lớn nhất là……………..

b. Chất có % khối lượng đồng nhỏ nhất là……………..

c. Các chất có % khối lượng đồng bằng nhau là……………..

Câu 7.18 Để loại tạp chất CuSO4 khỏi dung dịch FeSO4 ta làm như sau :

            A. Ngâm lá đồng vào dung dịch.                                   B. Cho AgNO3 vào dung dịch.

            C. Ngâm lá kẽm vào dung dịch.                                    D. Ngâm lá sắt vào dung dịch.

Câu 7.19. Chọn câu đúng trong các câu sau :

            A. Cu có thể tan trong dung dịch AlCl3.

            B. CuSO4 có thể dùng làm khô khí NH3.

            C. CuSO4 khan có thể dùng để phát hiện nước lẫn vào dầu hoả, xăng.

            D. Cu có thể tan trong dung dịch FeCl2.

Câu 7.20 Cấu hình electron của Cr3+ là phương án nào ?

            A. [Ar]3d5.                   B. [Ar]3d4.                   C. [Ar]3d3.                   D. [Ar]3d2.

Câu 7.21 Đốt nóng một ít bột sắt trong bình đựng khí oxi. Sau đó để nguội và cho vào bình đựng dung dịch HCl dư. Dung dịch thu được sau phản ứng gồm các chất

            A. FeCl2, FeCl3.           B. FeCl2, HCl.              C. FeCl3, HCl.             D. FeCl2, FeCl3, HCl.

Câu 7.22 Cho 2,52g một kim loại tác dụng hết với H2SO4 loãng, thu được 6,84g muối sunfat. Kim loại đó là kim loại nào ?

            A. Mg.                         B. Zn.                           C. Fe.                          D. Al.

Câu 7.23 Cho 1,92g Cu vào 100ml dung dịch chứa đồng thời KNO3 0,16M và H2SO4 0,4M thấy sinh ra một chất khí có tỉ khối hơi so với hiđro là 15. Thể tích khí (ở đktc) là 

     A. 0,672 lít.                         B. 0,0896 lít.                C. 0,3584 lít.                D. 0,448 lít.

Câu 7.24 Lấy 5,52g hỗn hợp A chứa Fe và kim loại M có hoá trị không đổi, chia làm 2 phần bằng nhau. Phần 1 tác dụng hết với dung dịch HCl thu được 2,016 lít hiđro (đktc). Đốt cháy hết phần 2 trong oxi thu được 4,36g hỗn hợp gồm Fe3O4 và oxit của M. Khối lượng mol của M; số gam của Fe, M (trong 5,52g hỗn hợp A) lần lượt là 

            A. 27; 3,36; 2,16.        B. 27; 1,68; 3,84.         C. 54; 3,36; 2,16.        D. 18; 3,36; 2,16.

Câu 7.25 Cho Fe tác dụng với dung dịch H2SO4 loãng, dung dịch thu được cho bay hơi được tinh thể FeSO4.7H2O có khối lượng là 55,6g. Thể tích khí hiđro (đktc) được giải phóng là bao nhiêu ?

            A. 8,16 lít.                    B. 7,33 lít.                    C. 4,48 lít.                    D. 10,36 lít.

Câu 7.26 Ngâm 1 đinh sắt nặng 4g trong dung dịch CuSO4, sau một thời gian lấy đinh sắt ra, sấy khô, cân nặng 4,2857g. Khối lượng sắt tham gia phản ứng là bao nhiêu ?

            A. 1,999g.                    B. 0,252g.                    C. 0,3999g       .           D. 2,100g.

Câu 7.27 Hỗn hợp A gồm FeO, Fe3O4, Fe2O3. Trong hỗn hợp A mỗi oxit đều có 0,5 mol. Khối lượng của hỗn hợp A là bao nhiêu gam ?

            A. 232.                                    B. 464.                         C. 116.                                    D. Đáp số khác.

Câu 7.28 Khử hoàn toàn 16g Fe2O3 bằng CO ở nhiệt độ cao. Khí đi ra sau phản ứng được dẫn vào dung dịch Ca(OH)2 dư. Khối lượng kết tủa thu được là bao nhiêu gam ?

            A. 15.                          B. 20.                           C. 25.                          D. 30.

Câu 7.29 Người ta dùng 200 tấn quặng hematit chứa 30% Fe2O3 để có thể sản xuất được m tấn gang có hàm lượng sắt 80%. Biết hiệu suất của quá trình 96%. Giá trị của m là 

            A. 50,4.                       B. 25,2.                        C. 35.                          D. 54,69.

Câu 7.30 Khi nung 2 mol Na2Cr2O7 thu được Na2O, Cr2O3 và  48g oxi. Vậy:

            A. Na2Cr2O7 đã hết.                                         B. Na2Cr2O7 còn dư 0,5 mol.

            C. Na2Cr2O7 còn dư 1 mol.                              D. Phản ứng này không thể xảy ra.

Câu 7.31 Một thanh đồng nặng 140,8g ngâm trong dung dịch AgNO3 một thời gian lấy ra rửa nhẹ sấy khô cân được 171,2g. Thể tích dung dịch AgNO3 32% (D=1,2 g/ml) đã tác dụng với thanh đồng là 

            A. 177 lít.                     B. 177 ml.                    C. 88,5 lít.                    D. 88,5 ml.

Câu 7.32 Cho 19,2g kim loại M tác dụng với dung dịch HNO3 loãng, dư thu được 4,48 lít khí duy nhất NO (đktc). M là kim loại nào ?

            A. Mg.                         B. Cu.                          C. Fe.                          D. Zn.

Câu 7.33 Cho 7,68g đồng tác dụng hết với HNO3 loãng thấy có khí NO thoát ra. Khối lượng muối nitrat sinh ra trong dung dịch là bao nhiêu gam ?

            A. 21,56.                     B. 21,65.                      C. 22,56.                     D. 22,65.

Câu 7.34 Đốt 12,8g đồng trong không khí thu được chất rắn X. Hoà tan chất rắn X trên vào dung dịch HNO3 0,5M thu được 448 ml khí NO (đktc). Khối lượng  chất rắn X là

            A. 15,52g.                    B. 10,08g.                    C. 16g.                         D. Đáp số khác.

Câu 7.35 Đốt 12,8g đồng trong không khí thu được chất rắn X. Hoà tan chất rắn X trên vào dung dịch HNO3 0,5M thu được 448 ml khí NO (đktc). Thể tích dung dịch HNO3 tối thiểu cần dùng để hoà tan chất rắn X là 

            A. 0,8 lít.                      B. 0,84 lít.                    C. 0,9333 lít                 D. 0,04 lít.

Câu 7.36 Cho 1,405g hỗn hợp Fe2O3, ZnO, CuO tác dụng vừa đủ với 250 ml dung dịch H2SO4 (loãng) 0,1M. Khối lượng muối sunfat khan thu được là

            A. 1,12 lít.                    B. 3,36 lít.                    C. 3,405g                     D. 2,24 lít.

Câu 7.37 Cho một ít bột sắt nguyên chất tác dụng hết với dung dịch H2SO4 loãng thu được 560ml khí ở đktc. Nếu cho gấp đôi lượng bột sắt trên tác dụng hết với CuSO4 thì thu được một chất rắn. Khối lượng bột sắt đã dùng trong 2 trường hợp trên và khối lượng chất rắn lần lượt là

            A. 1,4g; 2,8g; 3,2g.      B. 14g; 28g; 32g.         C. 1,4g; 2,8g; 10,8g.                D. Đáp số khác.

Câu 7.38 Khử 2,4g hỗn hợp gồm CuO và một oxit sắt có tỉ lệ số mol 1:1. Sau phản ứng thu được 1,76g chất rắn, đem hoà tan vào dung dịch HCl thấy bay ra 0,448 lít khí (đktc). Oxit sắt đó là ?

            A. FeO.                       B. Fe2O3.                     C. Fe3O4.                     D. Không xác định được.

Câu 7.39 Nguyên tử của nguyên tố X có tổng số hạt cơ bản (e, p, n) là 82, trong đó số hạt mang điện nhiều hơn số hạt không mang điện là 22. Nguyên tố X là

            A. sắt.                          B. brom.                       C photpho.                   D. crom.

Câu 7.40 Cho 100g hợp kim gồm có Fe, Cr và Al tác dụng với lượng dư dung dịch NaOH thu được 4,98 lít khí. Lấy bã rắn không tan cho tác dụng với một lượng dư dung dịch HCl (không có không khí) thu được 38,8 lít khí. Các khí đo ở đktc. Thành phần phần trăm của Fe, Cr và Al trong hợp kim lần lượt là 

            A. 83%, 13%, 4%.       B. 80%, 15%, 5%.       C. 12%, 84%, 4%.       D. 84%, 4,05%, 11,95%.

Câu 7.41 Hỗn hợp X gồm Cu và Fe, trong đó Cu chiếm 43,24% khối lượng. Cho 14,8g X tác dụng hết với dung dịch HCl thấy có V lít khí (đktc) bay ra. Giá trị của V là bao nhiêu ?

            A. 1,12 lít.                    B. 2,24 lít.                    C. 4,48 lít.                    D. 3,36 lít.

Câu 7.42 Khử m g bột CuO bằng khí hiđro ở nhiệt độ cao thu được hỗn hợp chất rắn X. Để hoà tan hết X cần vừa đủ 1 lít dung dịch HNO3 1M thu được 4,48 lít NO (đktc). Hiệu suất của phản ứng khử CuO là

            A. 70%.                       B. 75%.                       C. 80%.                       D. 85%.

Câu 7.43 Nhúng thanh sắt vào dung dịch CuSO4, sau một thời gian lấy thanh sắt ra rửa sạch, sấy khô thấy khối lượng tăng 1,2g. Có bao nhiêu gam Cu đã bám vào thanh sắt ?

            A. 4,8.                         B. 19,2.                        C. 2,4.                         D. 9,6.

Câu 7.44 Cho 20g hỗn hợp Fe và Mg tác dụng hết với dung dịch HCl thấy có 1g khí hiđro thoát ra. Dung dịch thu được nếu đem cô cạn thì lượng muối khan thu được là

            A. 50g.                         B. 55,5g.                      C. 60g.                         D. 60,5g.

Câu 7.45 Đốt một kim loại trong bình kín đựng khí clo thu được 32,5 g muối clorua và nhận thấy thể tích khí clo trong bình giảm 6,72 lít (đktc). Tên của kim loại đã dùng là

            A. Cu.                          B. Al.                           C. Zn.                          D. Fe.

Câu 7.46 Hoà tan hết mg hỗn hợp 3 oxit sắt vào dung dịch HCl được dung dịch X, cô cạn X thì thu được m1g hỗn hợp hai muối có tỉ lệ mol 1:1. Mặt khác, nếu sục thật chậm khí clo dư vào X rồi lại cô cạn thì lại thu được (m1 + 1,42)g muối khan. m có giá trị là 

     A. 5,64g.                             B. 6,89g.                      C. 6,08g.                      D. 5,92g.

Câu 7.47 Một dung dịch có hoà tan 3,25g sắt clorua tác dụng với dung dịch AgNO3 dư tạo ra 8,61g kết tủa trắng. Công thức của muối sắt đã dùng là

            A. FeCl2.                      B. FeCl3.          C. Cả FeCl2 và FeCl3.              D. Không xác định được.

Câu 7.48 Khi cho 1g muối sắt clorua tác dụng với lượng dư dung dịch AgNO3 tạo ra 2,6492 g AgCl. Công thức của muối sắt là

            A. FeCl2.                      B. FeCl3.          C. Cả FeCl2 và FeCl3.              D. Không xác định được.

Câu 7.49 Cho khí CO khử hoàn toàn đến sắt một hỗn hợp gồm: FeO, Fe2O3, Fe3O4 thấy có 4,48 lít khí CO2 (đktc) thoát ra. Thể tích CO (đktc) đã tham gia phản ứng là

            A. 1,12 lít.                    B. 2,24 lít.                    C. 3,36 lít.                    D. 4,48 lít.

Câu 7.50 Đốt nóng một hỗn hợp X gồm bột nhôm và Fe3O4 trong môi trường không có không khí. Những chất còn lại sau phản ứng, nếu cho tác dụng với dung dịch NaOH dư sẽ thu được 6,72 lít hiđro (đktc), nếu cho tác dụng với dung dịch HCl dư sẽ thu được 26,88 lít hiđro (đktc). Khối lượng Al và Fe3O4 trong hỗn hợp X lần lượt là

            A. 27g; 46,4g.              B. 27g; 69,6g.              C. 9g, 69,6g.                D. 16g; 42g.

Câu 7.51 Nung một mẫu thép thường có khối lượng 10g trong lượng khí oxi dư, thấy có 0,196 lít khí CO2 (0oC và 0,8 at) thoát ra. Thành phần phần trăm cacbon trong mẫu thép là

            A. 8,4%.                      B. 0,84%.                    C. 0,42%.                    D. Đáp số khác.

Câu 7.52 Khử hoàn toàn 16g bột sắt oxit bằng CO ở nhiệt độ cao. Sau khi phản ứng kết thúc, thu được chất rắn có khối lượng 11,2g. Thể tích CO (đktc) đã dùng là

            A. 4,48 lít.                    B.  6,72 lít.                   C. 0,672 lít.                  D. 2,24 lít.

Câu 7.53 Khử 9,6g hỗn hợp gồm Fe2O3 và FeO bằng khí hiđro ở nhiệt độ cao, thu được sắt và 2,88g nước. Thể tích hiđro đã dùng (170C và 725mmHg) là

            A. 3,584 lít.                  B. 4 lít.             C. 0,0053 lít.                D. Đáp số khác.

Câu 7.54 Hoà tan hoàn toàn 19,2g Cu vào dung dịch HNO3 loãng. Khí NO thu được đem oxi hoá thành NO2 rồi sục vào nước cùng với dòng khí oxi để chuyển hết thành HNO3. Thể tích khí oxi (đktc) đã tham gia vào quá trình trên là

            A. 22,4 lít.                    B. 3,36 lít.                    C. 4,48 lít.                    D. 6,72 lít.

Câu 7.55 Có 1g hợp kim đồng-nhôm được xử lí bằng lượng dư dung dịch NaOH, chất rắn còn lại được hoà tan hoàn toàn bằng dung dịch HNO3, sau đó làm bay hơi dung dịch và đun nóng, thu được chất rắn có khối lượng là 0,4g. Phần trăm về khối lượng của đồng, nhôm trong hợp kim lần lượt là

            A. 68%, 32%.              B. 40%, 60%.              C. 32%, 68%.              D. 60%, 40%.

Câu 7.56 Cho hỗn hợp gồm 2g Fe và 3g Cu vào dung dịch HNO3 thấy thoát ra 0,448 lít khí không màu hoá nâu trong không khí (đo ở đktc). Khối lượng muối khan thu được sau phản ứng là

            A. 5,4g.                        B. 8,72g.                      C. 4,84g.                      D. Đáp số khác.

Câu 7.57 Chất rắn X gồm 0,1 mol Fe2O3 và 0,1 mol Fe3O4. Hoà tan X bằng dung dịch HCl dư, thu được dung dịch Y. Cho NaOH vào Y, thu được kết tủa Z. Lọc lấy kết tủa, rửa sạch rồi đem nung trong không khí đến khối lượng không đổi thu được m g chất rắn. Giá trị của m là

            A. 40.                          B. 32.                           C. 48.                          D. 64.

Câu 7.58 Chia 4g hỗn hợp bột kim loại gồm nhôm, sắt và đồng thành 2 phần đều nhau.

- Phần 1 : tác dụng với lượng dư dung dịch HCl, thu được 560ml hiđro.

- Phần 2 : tác dụng với lượng dư dung dịch NaOH, thu được 336ml hiđro.

Các khí đo ở đktc. Số mol của Al, Fe trong 4g hỗn hợp lần lượt là:

A. 0,01; 0,01.                      B. 0,02; 0,01.               C. 0,02; 0,02.              D. Đáp số khác.



Câu 7.59 Cho sơ đồ phản ứng sau :

Cu + HNO3  muối + NO + nước.

Số nguyên tử đồng bị oxi hoá và số phân tử HNO3 bị khử lần lượt là

A.  3 và 8.                           B. 3 và 6.                     C. 3 và 3.                     D. 3 và 2.

Câu 7.60 Hoà tan m g kẽm vào dung dịch HCl dư thoát ra V1 lít khí (đktc). Cũng hoà tan m g kẽm vào dung dịch NaOH dư thoát ra V2 lít khí (đktc). Mối liên hệ giữa V1 và V2

            A. V1=V2.                    B. V1>V2.                    C.        V1<V2.             D. Không đủ cơ sở để so sánh.

Câu 7.61 Để khử ion Fe3+  trong dung dịch thành ion Fe2+ có thể dùng một lượng dư

            A. kim loại Mg.            B. kim loại Cu. C. kim loại Ba. D. kim loại Ag.

Câu 7.62 Cho các cặp kim loại nguyên chất tiếp xúc trực tiếp với nhau: Fe và Pb; Fe và Sn; Fe và Ni. Khi nhúng các cặp kim loại trên vào dung dịch axit, số cặp kim loại trong đó Fe bị phá huỷ trước là

            A. 4.                            B. 1.                             C. 2.                            D. 3.

Câu 7.63 Chỉ ra câu đúng trong các câu sau :

            1. Thêm dung dịch kiềm vào muối đicromat, muối này chuyển thành muối cromat.

            2. Hợp chất Cr(II) có tính khử đặc trưng, còn hợp chất Cr(VI) có tính oxi hoá mạnh.

            3. Các hợp chất CrO, Cr(OH)2 tác dụng được với dung dịch HCl còn CrO3 tác dụng được với dung dịch NaOH.

            4. Các hợp chất Cr2O3, Cr(OH)3, CrO, Cr(OH)2 đều có tính chất lưỡng tính.

            5. Crom là kim loại có tính khử mạnh hơn sắt.

            6. Crom là kim loại nên chỉ tạo nên chỉ tạo được oxit bazơ.

            7. Phương pháp sản xuất crom là điện phân Cr2O3 nóng chảy.

            8. Kim loại crom có thể cắt được thuỷ tinh.

            A. 1, 2, 3, 5, 8.                        B. 2, 3, 4, 5, 7, 8.                     C. 2, 3, 5, 6, 7, 8.                    D. 1, 3, 4, 5, 8.

Câu 7.64 Cho từng chất Fe, FeO, Fe(OH)2, Fe(OH)3, Fe3O4, Fe2O3, Fe(NO3)2, Fe(NO3)3, FeSO4, Fe2(SO4)3, FeCO3 lần lượt phản ứng với HNO3 đặc nóng. Số phản ứng thuộc loại oxi hoá- khử là

            A. 5.                            B. 8.                             C. 6.                            D. 7.

Câu 7.65 Một bột màu lục A thực tế không tan trong dung dịch loãng của axit hoặc kiềm. Khi nấu chảy với kiềm và có mặt không khí nó chuyển thành chất B có màu vàng và dễ tan trong nước, chất B tác dụng với axit chuyển thành chất C có màu da cam. Chất C bị lưu huỳnh khử thành chất A và oxi hoá axit clohiđric thành khí clo. Công thức phân tử các chất A, B và C lần lượt là :

            A. Cr2O3, Na2CrO4, K2Cr2O7.                                     B. Cr2O3, K2CrO4, K2Cr2O7.

C. Cr2O3, Na2Cr2O7, Na2CrO4.                                   D. Cr2O3, K2CrO4, Na2Cr2O7.

Câu 7.66 Dung dịch X có màu đỏ cam. Nếu cho thêm vào một lượng KOH, màu đỏ của dung dịch dần dần chuyển sang màu vàng tươi. Nếu thêm vào đó một lượng H2SO4, màu của dung dịch dần dần trở lại đỏ cam. Dung dịch X chứa chất có công thức phân tử là 

            A. K2Cr2O7.                 B. K2CrO4.                              C. KCr2O4.                  D. H2CrO4.

Câu 7.67 Cho các sơ đồ phản ứng :

            (1) X1 + HCl ® X2 + H2.                                             (2)        X1 + HNO3 ®  X4 + NO2 + H2O.

            (3) X2 + Cl2 ® X3.                                                                  (4) X2 + NaOH ®  X5  + NaCl.

            (5) X4 + NaOH ®  X6  + NaNO3.    (7) X5 + O2 + H2O ®  X6

            Các chất X1, X2, X3, X4, X5, X6 lần lượt là




































Câu 7.68 Cho sơ đồ phản ứng :

                        Cr + Sn2+   Cr3+ + Sn (1)

                        Cr + Cu2+   Cr3+ + Cu (2)

a. Khi cân bằng 2 phản ứng trên, hệ số của ion Cr3+ sẽ là

            A. 1.                            B. 2.                             C. 3.                                        D. 6.

b. Pin điện hoá Cr-Sn trong quá trình phóng điện xảy ra phản ứng (1). Biết        V.  Suất điện động chuẩn của pin điện hoá là

A. -0,6 V.                           B. 0,88 V.                    C. 0,6 V.                                  D. -0,88 V.

c. Pin điện hoá Cr-Cu trong quá trình phóng điện xảy ra phản ứng (2). Biết        V.  Suất điện động chuẩn của pin điện hoá là

A. 0,4 V.                             B. 1,08 V.                    C. -0,8 V.                                D. -0,4 V.

Câu 7.69 Hoà tan 58g muối CuSO4.5H2O trong nước, được 500 ml dung dịch.

a. Nồng độ mol/lít của dung dịch CuSO4 đã pha chế là

            A. 0,725 M.                 B. 0,464 M.                 C. 0,432 M.                             D. Đáp số khác.

b. Cho dần dần mạt sắt đến dư vào phương trình trên. Khối lượng kim loại thu được tăng (hoặc giảm) một lượng so với khối lượng sắt ban đầu là

            A. Giảm 1,856g.           B. Tăng 1,856g.           C.  Tăng 22,272g.                    D. Đáp số khác.

Câu 7.70 Hoà tan 10g FeSO4 có lẫn tạp chất là Fe2(SO4)3 trong nước, được 200 cm3 dung dịch. Biết 20 cm3 dung dịch này được axit hoá bằng  H2SO4 loãng làm mất màu tím của 25 cm3 dung dịch KMnO4 0,03 M.

a. Số mol Fe2+ tác dụng với 25 cm3 dung dịch KMnO4 0,03M là 

            A. 0,00375 mol.           B. 0,00075 mol.           C. 0,0075 mol.                         D. Đáp số khác.

b. Số g ion Fe2+ trong 200 cm3 dung dịch ban đầu :

            A. 0,02625g.                B. 1,68g.                      C. 2,1g.                                    D. 0,21g.

c. Phần trăm theo khối lượng FeSO4 tinh khiết là 

            A. 21%.                       B. 57%.                       C. 5,7%.                                  D. Đáp số khác.

Câu 7.71 Khối lượng quặng chứa 92,8% Fe3O4 để có 10 tấn gang chứa 4% C và một số tạp chất (Giả thiết hiệu suất của quá trình là 87,5%) là :

            A. 12,5 tấn.                  B. 16,3265 tấn.            C. 11,82 tấn.                            D. Đáp số khác.

Câu 7.72.

a. Cần bao nhiêu muối chứa 80% sắt(III) sunphat để có một lượng sắt bằng lượng sắt trong 1 tấn quặng hematit chứa 64% Fe2O3 ?

            A. 2 tấn.                       B. 0,8 tấn.                    C. 1.28 tấn.                              D. Đáp án khác.

b. Nếu lấy quặng hematit trên đem luyện gang, rồi luyện thép thì từ 10 tấn quặng sẽ thu được khối lượng thép chứa 0,1% C và các tạp chất là (giả sử hiệu suất của quá trình là 75%)

            A. 6 tấn.                       B. 1,5 tấn.                    C. 3,4 tấn.                                D. 2,2 tấn.

Câu 7.73. Ngâm một lá kẽm nặng 100g trong 100ml dung dịch chứa Cu(NO3)2 3M lẫn với Pb(NO3)2 1M. Sau phản ứng, lấy lá kẽm ra khỏi dung dịch, rửa nhẹ, sấy khô, đem cân thấy lá kẽm có khối lượng là

            A. 113,9g.                    B. 74g.                         C. 139,9g.                                D. 90g.

7.74. Cho 23,8g kim loại X tan hết trong dung dịch HCl tạo ra ion X2+. Dung dịch tạo thành có thể tác dụng vừa đủ với 200ml FeCl3 2M để tạo ra ion X4+. Kim loại X là

            A. Ni.                           B. Cr.                           C. Pb.                                      D. Sn.

Câu 7.75. Cho 40g hỗn hợp vàng, bạc, đồng, sắt, kẽm tác dụng với oxi dư nung nóng thu được 46,4g chất rắn X. Thể tích dung dịch HCl 2M có khả năng phản ứng với chất rắn X là

            A. 400ml.                     B. 300ml.                     C. 200ml.                                 D. 100ml.

Câu 7.76.  Khử 16g hỗn hợp các oxit kim loại FeO, Fe2O3, Fe3O4, CuO, PbO bằng khí CO ở nhiệt độ cao, khối lượng chất rắn thu được giảm 4,8g. Thể tích khí CO phản ứng (đktc) là

            A. 6,72 lít.                    B. 3,36 lít.                    C. 2,24 lít.                                D.  1,12 lít.

Câu 7.77. Hoà tan hoàn toàn 3,22g hỗn hợp X gồm Fe, Mg và Zn bằng một lượng vừa đủ dung dịch H2SO4 loãng, thu được 1,344 lít hiđro (đktc) và dung dịch chứa m g muối. Giá trị của m là

            A. 9,52.                       B. 10,27.                      C. 8,98.                                   D. 7,25.

Câu 7.78. Hoà tan hết hỗn hợp gồm 0,2 mol FeS2 và 0,3 mol FeS bằng lượng dư axit HNO3 đặc thu được V lít khí X (duy nhất). Giá trị của V (ở đktc) là

            A. 56 lít.                       B. 127,68 lít.                C. 63,84 lít.                              D. 12,768 lít.

Câu 7.79 Để thu được dung dịch CuSO4 16% cần lấy m1 g tinh thể CuSO4.5H2O cho vào m2g dung dịch CuSO4 8%. Tỉ lệ  là

            A. 1: 3.             B. 1: 4.                         C. 1: 5.                                     D. 1: 6.

Câu 7.80. Nung  m g bột sắt trong oxi, thu được 3g hỗn hợp chất rắn X. Hoà tan hết hỗn hợp X trong dung dịch HNO3 (dư), thoát ra 0,56 lít (đktc) NO (là sản phẩm khử duy nhất). Giá trị của m là

            A. 2,52.                       B. 2,22.                        C. 2,62.                                   D. 2,32.

Câu 7.81. Oxi hoá chậm m g Fe ngoài không khí thu được 12g hỗn hợp X gồm 3 oxit sắt và sắt dư. Hoà tan X vừa đủ bởi 200 ml dung dịch HNO3 thu được 2,24 lít khí NO duy nhất (đktc). Giá trị m và nồng độ dung dịch HNO3 lần lượt là

            A. 10,08g; 0,5M.         B. 5,04g; 1M.              C. 10,08g; 3,2M.                     D. 5,04g; 1,6M.

Câu 7.82 Cho hỗn hợp X gồm 3 oxit của sắt (Fe2O3, FeO, Fe3O4) với số mol bằng nhau. Lấy m1g X cho vào một ống sứ chịu nhiệt, nung nóng rồi cho một luồng khí CO đi qua, khí CO2 ra khỏi ống sứ được hấp thụ hết vào bình đựng lượng dư dung dịch Ca(OH)2 thu được m2g kết tủa trắng. Chất rắn (Y) còn lại trong ống sứ sau phản ứng có khối lượng là 19,2g gồm Fe, FeO và Fe2O3, cho hỗn hợp này tác dụng hết với dung dịch HNO3 đun nóng được 6,72 lít khí (có màu nâu đỏ) duy nhất (đktc). Tính khối lượng m1, m2.

     A. 20,88g; 10,5g.                B. 10,44g; 10,5g.         C. 10,44g; 20,685g                  D. 20,88g; 20,685g.

Câu 7.83  Đốt cháy hết mg hỗn hợp A gồm (Zn, Mg, Al) bằng oxi thu được (m +1,6)g oxit. Hỏi nếu cho mg hỗn hợp A tác dụng hết với hỗn hợp các axit loãng (H2SO4, HCl, HBr) thì thể tích H2 (đktc) thu được là

            A. 0,224 lít.                  B. 2,24 lít.                    C. 4,48 lít.                                D. 0,448 lít.

Câu 7.84  Để mg phoi bào sắt (X) ngoài không khí, sau một thời gian biến thành hỗn hợp (Y) có khối lượng 12g gồm Fe và các oxit FeO, Fe3O4, Fe2O3. Cho Y tác dụng hoàn toàn với axit H2SO4 đặc nóng dư thấy thoát ra 3,36 lít khí SO2 duy nhất (đktc). Tính khối lượng m của X.

            A. 5,04g.                      B. 8,16g.                      C. 7,2g.                                    D. 10,08g.

Câu 7.85 Cho 4,56g hỗn hợp Fe và một kim loại (X) thuộc nhóm II hoà tan hoàn toàn trong dung dịch HCl dư thấy tạo ra 2,016 lít khí (đktc). Mặt khác; 1,9g kim loại X nói trên không khử hết 4g CuO ở nhiệt độ cao. X là 

            A. Canxi                       B. Magie                      C. Bari                                     D. Beri

Câu 7.86  Cho 19,2g Cu vào 1 lít dung dịch gồm H2SO4 0,5M và KNO3 0,2M. Thể tích khí NO duy nhất thu được ở đktc là .

     A. 1,12 lít.                           B. 2,24 lít.                    C. 4,48 lít.                                D. 3,36 lít.

Câu 7.87 Khử hoàn toàn mg hỗn hợp 3 oxit sắt bằng CO dư ở nhiệt độ cao thành sắt kim loại. Hoà tan hết sắt thu được bằng dung dịch HCl dư thu được 7,62g chất rắn. Chất khí thoát ra được hấp thụ hết bằng dung dịch Ba(OH)2 dư thấy có 15,76g kết tủa trắng. Giá trị của m là

A. 5,2g                                B. 6,0g                         C. 4,64g                                   D. 5,26g

Câu 7.88 Dùng CO dư để khử hoàn toàn mg bột sắt oxit (FexOy), dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0,1M, thu được 5g kết tủa. Số mol khí CO2 thu được là

            A.  0,05 mol.                B. 0,05 và 0,15 mol.                 C. 0,025 mol.               D. 0,05 và 0,075 mol.

Câu 7.89  Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy) thành sắt, dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ba(OH)2 0,1M; thu được 9,85g kết tủa. Mặt khác hoà tan toàn bộ sắt kim loại thu được ở trên bằng dung dịch HCl dư rồi cô cạn thì thu được 12,7g muối khan. Công thức của sắt oxit là

            A. FeO.           B. Fe3O4.                     C. Fe2O3.         D. Chưa đủ dữ kiện để xác định.

Câu 7.90 Dùng CO dư để khử hoàn toàn m g bột sắt oxit (FexOy), dẫn toàn bộ lượng khí sinh ra đi thật chậm vào 1 lít dung dịch Ca(OH)2 0,1M, thu được 5g kết tủa. Mặt khác hoà tan toàn bộ mg bột sắt oxit (FexOy) bằng dung dịch HCl dư rồi cô cạn thì thu được 16,25g muối khan. m có giá trị là 

A. 8,00g.                             B. 15,1g.                      C. 16,00g.                    D. 11,6g.

Câu 7.91 Hoà tan hết 5,3g hỗn hợp kim loại gồm Mg, Zn, Al và Fe bằng dung dịch H2SO4 loãng, thu được 3,136 lít khí (đktc) và m g muối sunfat. m nhận giá trị bằng

A. 32,18g.               B. 19,02g.                    C. 18,74g.                                            D. 19,3g.

Câu 7.92 Hoà tan hết 1,72g hỗn hợp kim loại gồm Mg, Al, Zn và Fe bằng dung dịch HCl, thu được V lít khí (đktc) và 3,85g muối clorua khan. V nhận giá trị bằng

A. 1,344 lít.                         B. 2,688 lít.                  C. 1,12 lít.                    D. 3,36 lít.       

Câu 7.93.        Cho 2,81g hỗn hợp các oxit Fe3O4, Fe2O3, MgO, CuO tác dụng vừa đủ với 300ml dung dịch H2SO4 0,1M (loãng) thì khối lượng muối sunfat khan thu được là bao nhiêu ?

A. 4,5g.                               B. 3,45g.                      C. 5,21g           .           D. Chưa thể xác định.

Câu 7.94. Nung nóng 16,8g bột sắt ngoài không khí, sau một thời gian thu được m g hỗn hợp X gồm các oxit sắt, và sắt dư. Hoà tan hết hỗn hợp X bằng H2SO4 đặc nóng thu được 5,6 lít SO2 (đktc). Giá trị của m là

A. 24g.                    B. 26g.Q                                  C. 20g.                                     D. 22g.

Câu 7.95.  Một dung dịch có chứa 2 cation là Fe2+ 0,1 mol; Al3+ 0,2 mol và 2 anion Cl- x mol, SO42- y mol. Khi cô cạn dung dịch, thu được 46,9g chất rắn khan. x và y có giá trị là 

A. x = 0,02 và y = 0,03.                                                      B. x = 0,03 và y = 0,02.

C. x = 0,2 và y = 0,3           .                                               D. x = 0,3 và y = 0,2.

Câu 7.96.  Khử hoàn toàn 4,8g một oxit của kim loại M thành kim loại cần 2,016 lít H2 (đktc). Kim loại thu được đem hoà tan hết bằng dung dịch H2SO4 loãng thấy tạo ra 1,344 lít H2. Tìm công thức của oxit.

A. FeO.                   B. Fe3O4.                     C. Fe2O3.                                             D. Oxit khác.   

Câu 7.97 Cho 1,75g hỗn hợp gồm 3 kim loại Fe, Al, Zn tan hết trong dung dịch HCl thì thu được 1,12 khí (đktc) và dung dịch X. Cô cạn x thu được m g muối. m có giá trị là

A. 3,525g.               B. 5,375g.                                C. 5,3g.                                    D. 5,4g.

Câu 7.98. Khử hoàn toàn a g FexOy bằng khí CO ở nhiệt độ cao thu được 0,84g Fe và 0,88g khí CO2. Tính a ?

A. 1,72g.                 B. 1,16g.                      C. 1,48g.                      D. Không xác định được.

Câu 7.99 Cho CO qua ống sứ chứa 15,2g hỗn hợp CuO, FeO nung nóng, sau một thời gian thu được 13,6g rắn X và hỗn hợp khí Y. Sục Y vào dung dịch nước vôi trong có dư, thu được mg kết tủa Z. m có giá trị là

A. 10 g.                   B. 5 g.                          C. 7,5 g.                       D. Kết quả khác.

Câu 7.100  Oxi hoá hoàn toàn 0,792g hỗn hợp bột gồm Fe và Cu ta thu được 1,032g hỗn hợp các oxit (hỗn hợp X). Thể tích khí H2 (đktc) tối thiểu cần để khử hoàn toàn các oxit thành kim loại là

            A. 0,672 lít.                  B. 0,4256 lít.                            C. 0,896 lít.                  D. 0,336 lít.

Câu 7.101  Oxi hoá hoàn toàn 0,728g bột Fe ta thu được 1,016g hỗn hợp các oxit sắt (hỗn hợp X). Hoà tan X bằng dung lịch HNO3 loãng, dư. Thể tích khí NO duy nhất bay ra (ở đktc) là 

A. 0,336 lít.                         B. 0,0336 lít.                C. 0,896 lít.                              D. 0,0224 lít.

Câu 7.102 Cho luồng khí CO đi qua ống sứ đựng m g Fe2O3 ở nhiệt độ cao một thời gian, người ta thu được 6,72g hỗn hợp gồm 4 chất rắn khác nhau. Đem hoà tan hoàn toàn hỗn hợp này vào dung dịch HNO3 dư tạo thành 0,448 lít khí NO duy nhất. Giá trị m là

A. 8g.                      B. 8,2g.                                    C. 7,2g.                                                D. 6,8g.





























a/1; b/7






a/2; b/6



























































































































































































Sang Võ Thái,
22:39, 27 thg 2, 2012